C14H19NO2 — CID 139576281
(2Z,4E)-3-[3-(aminomethyl)phenyl]hepta-2,4-diene-2,5-diol (PubChem CID 139576281) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (2Z,4E)-3-[3-(aminomethyl)phenyl]hepta-2,4-diene-2,5-diol.
| Compound Name | (2Z,4E)-3-[3-(aminomethyl)phenyl]hepta-2,4-diene-2,5-diol |
|---|---|
| PubChem CID | 139576281 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (2Z,4E)-3-[3-(aminomethyl)phenyl]hepta-2,4-diene-2,5-diol |
| SMILES | CC/C(O)=C\C(=C(/C)O)c1cccc(CN)c1 |
| InChI | InChI=1S/C14H19NO2/c1-3-13(17)8-14(10(2)16)12-6-4-5-11(7-12)9-15/h4-8,16-17H,3,9,15H2,1-2H3/b13-8+,14-10- |
| InChIKey | LNJANULLVJXFCC-GVCYOOEQSA-N |
| XLogP | 3.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|