C6H8N4OS — CID 143941392
4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrrolidin-2-one (PubChem CID 143941392) has the molecular formula C6H8N4OS and a molecular weight of 184.22 g/mol. Its IUPAC name is 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrrolidin-2-one.
| Compound Name | 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 143941392 |
| Molecular Formula | C6H8N4OS |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 4-(2-sulfanyl-1,2,4-triazol-3-yl)pyrrolidin-2-one |
| SMILES | O=C1CC(c2ncnn2S)CN1 |
| InChI | InChI=1S/C6H8N4OS/c11-5-1-4(2-7-5)6-8-3-9-10(6)12/h3-4,12H,1-2H2,(H,7,11) |
| InChIKey | KJYJHOVZXDPWHD-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|