C10H14N2 — CID 143942469
ethane;4-methylpyrrolo[1,2-a]pyrazine (PubChem CID 143942469) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is ethane;4-methylpyrrolo[1,2-a]pyrazine.
| Compound Name | ethane;4-methylpyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 143942469 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | ethane;4-methylpyrrolo[1,2-a]pyrazine |
| SMILES | CC.Cc1cncc2cccn12 |
| InChI | InChI=1S/C8H8N2.C2H6/c1-7-5-9-6-8-3-2-4-10(7)8;1-2/h2-6H,1H3;1-2H3 |
| InChIKey | KPLZYWDSFUJRTM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |