C11H23NO2 — CID 143943100
ethane;3-methoxy-1,2-dihydropyrrol-5-one;2-methylpropane (PubChem CID 143943100) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is ethane;3-methoxy-1,2-dihydropyrrol-5-one;2-methylpropane.
| Compound Name | ethane;3-methoxy-1,2-dihydropyrrol-5-one;2-methylpropane |
|---|---|
| PubChem CID | 143943100 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | ethane;3-methoxy-1,2-dihydropyrrol-5-one;2-methylpropane |
| SMILES | CC.CC(C)C.COC1=CC(=O)NC1 |
| InChI | InChI=1S/C5H7NO2.C4H10.C2H6/c1-8-4-2-5(7)6-3-4;1-4(2)3;1-2/h2H,3H2,1H3,(H,6,7);4H,1-3H3;1-2H3 |
| InChIKey | YSZBVSKVPPDIQL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |