C10H17NO2 — CID 19982667
3-hexoxy-1,2-dihydropyrrol-5-one (PubChem CID 19982667) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-hexoxy-1,2-dihydropyrrol-5-one.
| Compound Name | 3-hexoxy-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 19982667 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3-hexoxy-1,2-dihydropyrrol-5-one |
| SMILES | CCCCCCOC1=CC(=O)NC1 |
| InChI | InChI=1S/C10H17NO2/c1-2-3-4-5-6-13-9-7-10(12)11-8-9/h7H,2-6,8H2,1H3,(H,11,12) |
| InChIKey | PZLHZPHABOZQBO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|