About 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one
3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one (PubChem CID 19982539) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one |
| PubChem CID | 19982539 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one |
| SMILES | CC(C)CCCCOC1=CC(=O)NC1 |
| InChI | InChI=1S/C11H19NO2/c1-9(2)5-3-4-6-14-10-7-11(13)12-8-10/h7,9H,3-6,8H2,1-2H3,(H,12,13) |
| InChIKey | PIGKQZULXARUMG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one (CID 19982539) is 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one is CC(C)CCCCOC1=CC(=O)NC1.
What is the InChIKey of 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one?
The InChIKey is PIGKQZULXARUMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-9(2)5-3-4-6-14-10-7-11(13)12-8-10/h7,9H,3-6,8H2,1-2H3,(H,12,13).
What are the key properties of 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one?
3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one has a molecular weight of 197.28 g/mol, XLogP of 1.84, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methylhexoxy)-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 19982539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).