C14H14Cl2N2O3S — CID 143943589
2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol (PubChem CID 143943589) has the molecular formula C14H14Cl2N2O3S and a molecular weight of 361.25 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol.
| Compound Name | 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol |
|---|---|
| PubChem CID | 143943589 |
| Molecular Formula | C14H14Cl2N2O3S |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol |
| SMILES | O=C(O)c1coc(CNC2CC2)n1.Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H10N2O3.C6H4Cl2S/c11-8(12)6-4-13-7(10-6)3-9-5-1-2-5;7-4-1-2-6(9)5(8)3-4/h4-5,9H,1-3H2,(H,11,12);1-3,9H |
| InChIKey | SNWAVXXUPKPCLJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|