About 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol
2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol (PubChem CID 143943589) has the molecular formula C14H14Cl2N2O3S
and a molecular weight of 361.25 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol.
Molecular Properties
| Compound Name | 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol |
| PubChem CID | 143943589 |
| Molecular Formula | C14H14Cl2N2O3S |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol |
| SMILES | O=C(O)c1coc(CNC2CC2)n1.Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H10N2O3.C6H4Cl2S/c11-8(12)6-4-13-7(10-6)3-9-5-1-2-5;7-4-1-2-6(9)5(8)3-4/h4-5,9H,1-3H2,(H,11,12);1-3,9H |
| InChIKey | SNWAVXXUPKPCLJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol?
The IUPAC name of 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol (CID 143943589) is 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol.
What is the SMILES notation for 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol?
The canonical SMILES for 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol is O=C(O)c1coc(CNC2CC2)n1.Sc1ccc(Cl)cc1Cl.
What is the InChIKey of 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol?
The InChIKey is SNWAVXXUPKPCLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3.C6H4Cl2S/c11-8(12)6-4-13-7(10-6)3-9-5-1-2-5;7-4-1-2-6(9)5(8)3-4/h4-5,9H,1-3H2,(H,11,12);1-3,9H.
What are the key properties of 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol?
2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol has a molecular weight of 361.25 g/mol, XLogP of 3.91, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(cyclopropylamino)methyl]-1,3-oxazole-4-carboxylic acid;2,4-dichlorobenzenethiol is sourced from PubChem (CID 143943589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).