C11H24N2 — CID 143945003
ethane;(Z)-4-ethenyl-5-N-methylhex-4-ene-1,5-diamine (PubChem CID 143945003) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is ethane;(Z)-4-ethenyl-5-N-methylhex-4-ene-1,5-diamine.
| Compound Name | ethane;(Z)-4-ethenyl-5-N-methylhex-4-ene-1,5-diamine |
|---|---|
| PubChem CID | 143945003 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | ethane;(Z)-4-ethenyl-5-N-methylhex-4-ene-1,5-diamine |
| SMILES | C=C/C(CCCN)=C(/C)NC.CC |
| InChI | InChI=1S/C9H18N2.C2H6/c1-4-9(6-5-7-10)8(2)11-3;1-2/h4,11H,1,5-7,10H2,2-3H3;1-2H3/b9-8+; |
| InChIKey | QLERHIDFAKIRED-HRNDJLQDSA-N |
| XLogP | 2.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|