C9H17N3 — CID 129204127
(E)-2-N-methyl-1-(pent-1-en-3-ylideneamino)prop-1-ene-1,2-diamine (PubChem CID 129204127) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (E)-2-N-methyl-1-(pent-1-en-3-ylideneamino)prop-1-ene-1,2-diamine.
| Compound Name | (E)-2-N-methyl-1-(pent-1-en-3-ylideneamino)prop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 129204127 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (E)-2-N-methyl-1-(pent-1-en-3-ylideneamino)prop-1-ene-1,2-diamine |
| SMILES | C=CC(CC)=N/C(N)=C(\C)NC |
| InChI | InChI=1S/C9H17N3/c1-5-8(6-2)12-9(10)7(3)11-4/h5,11H,1,6,10H2,2-4H3/b9-7+,12-8? |
| InChIKey | SAIHDVBIOORUEU-FIMQDFCFSA-N |
| XLogP | 1.39 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|