About N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane
N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane (PubChem CID 174664874) has the molecular formula C8H22N2OSi
and a molecular weight of 190.36 g/mol. Its IUPAC name is N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane |
| PubChem CID | 174664874 |
| Molecular Formula | C8H22N2OSi |
| Molecular Weight | 190.36 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane |
| SMILES | C=CC(CC)=NO.CN(C)C.[SiH4] |
| InChI | InChI=1S/C5H9NO.C3H9N.H4Si/c1-3-5(4-2)6-7;1-4(2)3;/h3,7H,1,4H2,2H3;1-3H3;1H4 |
| InChIKey | NTEDMAWCOMYUQD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane?
The IUPAC name of N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane (CID 174664874) is N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane.
What is the SMILES notation for N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane?
The canonical SMILES for N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane is C=CC(CC)=NO.CN(C)C.[SiH4].
What is the InChIKey of N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane?
The InChIKey is NTEDMAWCOMYUQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C3H9N.H4Si/c1-3-5(4-2)6-7;1-4(2)3;/h3,7H,1,4H2,2H3;1-3H3;1H4.
What are the key properties of N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane?
N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane has a molecular weight of 190.36 g/mol, XLogP of 0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;N-pent-1-en-3-ylidenehydroxylamine;silane is sourced from PubChem (CID 174664874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).