C20H23F3N6OS — CID 143946088
[(1R)-3-methyl-4-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol (PubChem CID 143946088) has the molecular formula C20H23F3N6OS and a molecular weight of 452.51 g/mol. Its IUPAC name is [(1R)-3-methyl-4-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol.
| Compound Name | [(1R)-3-methyl-4-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 143946088 |
| Molecular Formula | C20H23F3N6OS |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [(1R)-3-methyl-4-[[6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol |
| SMILES | Cc1nc(NCC(F)(F)F)nc(NC2C[C@H](CO)CC2C)c1-c1nc2cnccc2s1 |
| InChI | InChI=1S/C20H23F3N6OS/c1-10-5-12(8-30)6-13(10)27-17-16(18-28-14-7-24-4-3-15(14)31-18)11(2)26-19(29-17)25-9-20(21,22)23/h3-4,7,10,12-13,30H,5-6,8-9H2,1-2H3,(H2,25,26,27,29)/t10?,12-,13?/m1/s1 |
| InChIKey | AEXUOEQQLCDSHQ-YXMLORGKSA-N |
| XLogP | 4.25 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |