C20H23F3N6O2 — CID 143946314
[(3S)-3-[[6-methyl-5-([1,3]oxazolo[4,5-c]pyridin-2-yl)-2-(3,3,3-trifluoropropylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol (PubChem CID 143946314) has the molecular formula C20H23F3N6O2 and a molecular weight of 436.44 g/mol. Its IUPAC name is [(3S)-3-[[6-methyl-5-([1,3]oxazolo[4,5-c]pyridin-2-yl)-2-(3,3,3-trifluoropropylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol.
| Compound Name | [(3S)-3-[[6-methyl-5-([1,3]oxazolo[4,5-c]pyridin-2-yl)-2-(3,3,3-trifluoropropylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 143946314 |
| Molecular Formula | C20H23F3N6O2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | [(3S)-3-[[6-methyl-5-([1,3]oxazolo[4,5-c]pyridin-2-yl)-2-(3,3,3-trifluoropropylamino)pyrimidin-4-yl]amino]cyclopentyl]methanol |
| SMILES | Cc1nc(NCCC(F)(F)F)nc(N[C@H]2CCC(CO)C2)c1-c1nc2cnccc2o1 |
| InChI | InChI=1S/C20H23F3N6O2/c1-11-16(18-28-14-9-24-6-4-15(14)31-18)17(27-13-3-2-12(8-13)10-30)29-19(26-11)25-7-5-20(21,22)23/h4,6,9,12-13,30H,2-3,5,7-8,10H2,1H3,(H2,25,26,27,29)/t12?,13-/m0/s1 |
| InChIKey | GIUQIWXZHAATKH-ABLWVSNPSA-N |
| XLogP | 3.93 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |