C26H34N6O3S — CID 143946707
(1R,2S,3R,5R)-3-[[2-[[(2E,4Z)-2-ethylhexa-2,4-dienyl]-methylamino]-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 143946707) has the molecular formula C26H34N6O3S and a molecular weight of 510.66 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-[[(2E,4Z)-2-ethylhexa-2,4-dienyl]-methylamino]-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-[[(2E,4Z)-2-ethylhexa-2,4-dienyl]-methylamino]-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 143946707 |
| Molecular Formula | C26H34N6O3S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-[[(2E,4Z)-2-ethylhexa-2,4-dienyl]-methylamino]-6-methyl-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | C/C=C\C=C(/CC)CN(C)c1nc(C)c(-c2nc3cnccc3s2)c(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C26H34N6O3S/c1-5-7-8-16(6-2)13-32(4)26-28-15(3)21(25-30-19-12-27-10-9-20(19)36-25)24(31-26)29-18-11-17(14-33)22(34)23(18)35/h5,7-10,12,17-18,22-23,33-35H,6,11,13-14H2,1-4H3,(H,28,29,31)/b7-5-,16-8+/t17-,18-,22-,23+/m1/s1 |
| InChIKey | PUKWLKFRSJASAW-NPGAFADUSA-N |
| XLogP | 3.32 |
| TPSA | 127.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|