C17H17ClFN5O3S — CID 46175481
(1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(6-fluoro-1,3-benzothiazol-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 46175481) has the molecular formula C17H17ClFN5O3S and a molecular weight of 425.87 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(6-fluoro-1,3-benzothiazol-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(6-fluoro-1,3-benzothiazol-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 46175481 |
| Molecular Formula | C17H17ClFN5O3S |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-amino-6-chloro-5-(6-fluoro-1,3-benzothiazol-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Nc1nc(Cl)c(-c2nc3ccc(F)cc3s2)c(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C17H17ClFN5O3S/c18-14-11(16-22-8-2-1-7(19)4-10(8)28-16)15(24-17(20)23-14)21-9-3-6(5-25)12(26)13(9)27/h1-2,4,6,9,12-13,25-27H,3,5H2,(H3,20,21,23,24)/t6-,9-,12-,13+/m1/s1 |
| InChIKey | DQRBVQLDSDLZBQ-MAWPOWPHSA-N |
| XLogP | 1.64 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |