C22H23FO — CID 143950505
(1R)-1-[4-fluoro-2-[(3Z)-penta-1,3-dien-2-yl]phenoxy]-2-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 143950505) has the molecular formula C22H23FO and a molecular weight of 322.42 g/mol. Its IUPAC name is (1R)-1-[4-fluoro-2-[(3Z)-penta-1,3-dien-2-yl]phenoxy]-2-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R)-1-[4-fluoro-2-[(3Z)-penta-1,3-dien-2-yl]phenoxy]-2-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 143950505 |
| Molecular Formula | C22H23FO |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (1R)-1-[4-fluoro-2-[(3Z)-penta-1,3-dien-2-yl]phenoxy]-2-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=C(/C=C\C)c1cc(F)ccc1O[C@H]1c2ccccc2CCC1C |
| InChI | InChI=1S/C22H23FO/c1-4-7-15(2)20-14-18(23)12-13-21(20)24-22-16(3)10-11-17-8-5-6-9-19(17)22/h4-9,12-14,16,22H,2,10-11H2,1,3H3/b7-4-/t16?,22-/m1/s1 |
| InChIKey | GPXNOKXPYITNPH-ARCRHQQTSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|