C8H9NO2 — CID 14395198
5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carbaldehyde (PubChem CID 14395198) has the molecular formula C8H9NO2 and a molecular weight of 151.17 g/mol. Its IUPAC name is 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carbaldehyde.
| Compound Name | 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carbaldehyde |
|---|---|
| PubChem CID | 14395198 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 5-oxo-3,6,7,8-tetrahydropyrrolizine-1-carbaldehyde |
| SMILES | O=CC1=CCN2C(=O)CCC12 |
| InChI | InChI=1S/C8H9NO2/c10-5-6-3-4-9-7(6)1-2-8(9)11/h3,5,7H,1-2,4H2 |
| InChIKey | XJKUUECRFIYIHK-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|