C22H17N5O2S — CID 143952314
3-[2-(4-cyano-3-methyl-1,2-thiazol-5-yl)hydrazinyl]-2-hydroxy-N-phenylnaphthalene-1-carboxamide (PubChem CID 143952314) has the molecular formula C22H17N5O2S and a molecular weight of 415.48 g/mol. Its IUPAC name is 3-[2-(4-cyano-3-methyl-1,2-thiazol-5-yl)hydrazinyl]-2-hydroxy-N-phenylnaphthalene-1-carboxamide.
| Compound Name | 3-[2-(4-cyano-3-methyl-1,2-thiazol-5-yl)hydrazinyl]-2-hydroxy-N-phenylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 143952314 |
| Molecular Formula | C22H17N5O2S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 3-[2-(4-cyano-3-methyl-1,2-thiazol-5-yl)hydrazinyl]-2-hydroxy-N-phenylnaphthalene-1-carboxamide |
| SMILES | Cc1nsc(NNc2cc3ccccc3c(C(=O)Nc3ccccc3)c2O)c1C#N |
| InChI | InChI=1S/C22H17N5O2S/c1-13-17(12-23)22(30-27-13)26-25-18-11-14-7-5-6-10-16(14)19(20(18)28)21(29)24-15-8-3-2-4-9-15/h2-11,25-26,28H,1H3,(H,24,29) |
| InChIKey | GZSWKSAUUHCZQT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|