C17H17ClN4O4 — CID 143953565
2-[7-chloro-5-[(4-nitrophenyl)methyl]imidazo[1,2-c]pyrimidin-8-yl]acetic acid;ethane (PubChem CID 143953565) has the molecular formula C17H17ClN4O4 and a molecular weight of 376.80 g/mol. Its IUPAC name is 2-[7-chloro-5-[(4-nitrophenyl)methyl]imidazo[1,2-c]pyrimidin-8-yl]acetic acid;ethane.
| Compound Name | 2-[7-chloro-5-[(4-nitrophenyl)methyl]imidazo[1,2-c]pyrimidin-8-yl]acetic acid;ethane |
|---|---|
| PubChem CID | 143953565 |
| Molecular Formula | C17H17ClN4O4 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[7-chloro-5-[(4-nitrophenyl)methyl]imidazo[1,2-c]pyrimidin-8-yl]acetic acid;ethane |
| SMILES | CC.O=C(O)Cc1c(Cl)nc(Cc2ccc([N+](=O)[O-])cc2)n2ccnc12 |
| InChI | InChI=1S/C15H11ClN4O4.C2H6/c16-14-11(8-13(21)22)15-17-5-6-19(15)12(18-14)7-9-1-3-10(4-2-9)20(23)24;1-2/h1-6H,7-8H2,(H,21,22);1-2H3 |
| InChIKey | KIXYQEAWFWWEFH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|