C19H33N3O — CID 1439550
(2R)-2-(4-cyclohexylpiperazin-1-yl)-N,N-bis(prop-2-enyl)propanamide (PubChem CID 1439550) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is (2R)-2-(4-cyclohexylpiperazin-1-yl)-N,N-bis(prop-2-enyl)propanamide.
| Compound Name | (2R)-2-(4-cyclohexylpiperazin-1-yl)-N,N-bis(prop-2-enyl)propanamide |
|---|---|
| PubChem CID | 1439550 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | (2R)-2-(4-cyclohexylpiperazin-1-yl)-N,N-bis(prop-2-enyl)propanamide |
| SMILES | C=CCN(CC=C)C(=O)[C@@H](C)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H33N3O/c1-4-11-22(12-5-2)19(23)17(3)20-13-15-21(16-14-20)18-9-7-6-8-10-18/h4-5,17-18H,1-2,6-16H2,3H3/t17-/m1/s1 |
| InChIKey | NZEDRVNYWBESOQ-QGZVFWFLSA-N |
| XLogP | 2.53 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|