C15H21N5O3 — CID 166303756
2-(3,4-dioxo-2,6,7,9-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl)-N,N-bis(prop-2-enyl)propanamide (PubChem CID 166303756) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-(3,4-dioxo-2,6,7,9-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl)-N,N-bis(prop-2-enyl)propanamide.
| Compound Name | 2-(3,4-dioxo-2,6,7,9-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl)-N,N-bis(prop-2-enyl)propanamide |
|---|---|
| PubChem CID | 166303756 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-(3,4-dioxo-2,6,7,9-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl)-N,N-bis(prop-2-enyl)propanamide |
| SMILES | C=CCN(CC=C)C(=O)C(C)N1CCn2c(n[nH]c(=O)c2=O)C1 |
| InChI | InChI=1S/C15H21N5O3/c1-4-6-18(7-5-2)14(22)11(3)19-8-9-20-12(10-19)16-17-13(21)15(20)23/h4-5,11H,1-2,6-10H2,3H3,(H,17,21) |
| InChIKey | LJBLLHSRVWAJMH-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|