C17H20N4O3 — CID 51496315
(2R)-2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]-N,N-bis(prop-2-enyl)propanamide (PubChem CID 51496315) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is (2R)-2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]-N,N-bis(prop-2-enyl)propanamide.
| Compound Name | (2R)-2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]-N,N-bis(prop-2-enyl)propanamide |
|---|---|
| PubChem CID | 51496315 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (2R)-2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]-N,N-bis(prop-2-enyl)propanamide |
| SMILES | C=CCN(CC=C)C(=O)[C@@H](C)n1nc(-c2ccco2)cc(N)c1=O |
| InChI | InChI=1S/C17H20N4O3/c1-4-8-20(9-5-2)16(22)12(3)21-17(23)13(18)11-14(19-21)15-7-6-10-24-15/h4-7,10-12H,1-2,8-9,18H2,3H3/t12-/m1/s1 |
| InChIKey | JTBLHDWYWJWZGQ-GFCCVEGCSA-N |
| XLogP | 1.85 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|