C20H25N5O4 — CID 51592580
(4aS,8aR)-4-[2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]acetyl]-3,3-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-quinoxalin-2-one (PubChem CID 51592580) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is (4aS,8aR)-4-[2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]acetyl]-3,3-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-quinoxalin-2-one.
| Compound Name | (4aS,8aR)-4-[2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]acetyl]-3,3-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 51592580 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (4aS,8aR)-4-[2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]acetyl]-3,3-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-quinoxalin-2-one |
| SMILES | CC1(C)C(=O)N[C@@H]2CCCC[C@@H]2N1C(=O)Cn1nc(-c2ccco2)cc(N)c1=O |
| InChI | InChI=1S/C20H25N5O4/c1-20(2)19(28)22-13-6-3-4-7-15(13)25(20)17(26)11-24-18(27)12(21)10-14(23-24)16-8-5-9-29-16/h5,8-10,13,15H,3-4,6-7,11,21H2,1-2H3,(H,22,28)/t13-,15+/m1/s1 |
| InChIKey | YQLVCIBQYNACIU-HIFRSBDPSA-N |
| XLogP | 1.13 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |