C21H22ClN5O3 — CID 92571086
2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]-N-(3-chloro-4-piperidin-1-ylphenyl)acetamide (PubChem CID 92571086) has the molecular formula C21H22ClN5O3 and a molecular weight of 427.89 g/mol. Its IUPAC name is 2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]-N-(3-chloro-4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]-N-(3-chloro-4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 92571086 |
| Molecular Formula | C21H22ClN5O3 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]-N-(3-chloro-4-piperidin-1-ylphenyl)acetamide |
| SMILES | Nc1cc(-c2ccco2)nn(CC(=O)Nc2ccc(N3CCCCC3)c(Cl)c2)c1=O |
| InChI | InChI=1S/C21H22ClN5O3/c22-15-11-14(6-7-18(15)26-8-2-1-3-9-26)24-20(28)13-27-21(29)16(23)12-17(25-27)19-5-4-10-30-19/h4-7,10-12H,1-3,8-9,13,23H2,(H,24,28) |
| InChIKey | PYBGXXWQUIEXNJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|