C10H10N4O3 — CID 51589118
2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]acetamide (PubChem CID 51589118) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]acetamide.
| Compound Name | 2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]acetamide |
|---|---|
| PubChem CID | 51589118 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-[5-amino-3-(furan-2-yl)-6-oxopyridazin-1-yl]acetamide |
| SMILES | NC(=O)Cn1nc(-c2ccco2)cc(N)c1=O |
| InChI | InChI=1S/C10H10N4O3/c11-6-4-7(8-2-1-3-17-8)13-14(10(6)16)5-9(12)15/h1-4H,5,11H2,(H2,12,15) |
| InChIKey | AMBOAZZNJRYOCB-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 117.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |