C10H17N3O — CID 143956409
N-[2-[[(1E,3Z)-5-methyliminopenta-1,3-dienyl]amino]ethyl]acetamide (PubChem CID 143956409) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is N-[2-[[(1E,3Z)-5-methyliminopenta-1,3-dienyl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[(1E,3Z)-5-methyliminopenta-1,3-dienyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 143956409 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-[2-[[(1E,3Z)-5-methyliminopenta-1,3-dienyl]amino]ethyl]acetamide |
| SMILES | C/N=C/C=C\C=C\NCCNC(C)=O |
| InChI | InChI=1S/C10H17N3O/c1-10(14)13-9-8-12-7-5-3-4-6-11-2/h3-7,12H,8-9H2,1-2H3,(H,13,14)/b4-3-,7-5+,11-6+ |
| InChIKey | PFZRYDGDAYMJOT-IYDOLVBSSA-N |
| XLogP | 0.48 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|