About 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne
1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne (PubChem CID 143958976) has the molecular formula C15H20O
and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne.
Molecular Properties
| Compound Name | 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne |
| PubChem CID | 143958976 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne |
| SMILES | C#CC.C=C(CC)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C12H16O.C3H4/c1-4-10(3)11-6-8-12(9-7-11)13-5-2;1-3-2/h6-9H,3-5H2,1-2H3;1H,2H3 |
| InChIKey | RKXANRXOCCHARL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne?
The IUPAC name of 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne (CID 143958976) is 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne.
What is the SMILES notation for 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne?
The canonical SMILES for 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne is C#CC.C=C(CC)c1ccc(OCC)cc1.
What is the InChIKey of 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne?
The InChIKey is RKXANRXOCCHARL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O.C3H4/c1-4-10(3)11-6-8-12(9-7-11)13-5-2;1-3-2/h6-9H,3-5H2,1-2H3;1H,2H3.
What are the key properties of 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne?
1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne has a molecular weight of 216.32 g/mol, XLogP of 4.15, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-1-en-2-yl-4-ethoxybenzene;prop-1-yne is sourced from PubChem (CID 143958976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).