C22H18F2IN5O — CID 143960033
2-[3-[(2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]propyl]-1-iodoguanidine (PubChem CID 143960033) has the molecular formula C22H18F2IN5O and a molecular weight of 533.32 g/mol. Its IUPAC name is 2-[3-[(2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]propyl]-1-iodoguanidine.
| Compound Name | 2-[3-[(2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]propyl]-1-iodoguanidine |
|---|---|
| PubChem CID | 143960033 |
| Molecular Formula | C22H18F2IN5O |
| Molecular Weight | 533.32 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | 2-[3-[(2,10-difluoro-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]propyl]-1-iodoguanidine |
| SMILES | N/C(=N\CCCOc1c2[nH]c3ccc(F)cc3c2cc2c1[nH]c1ccc(F)cc12)NI |
| InChI | InChI=1S/C22H18F2IN5O/c23-11-2-4-17-13(8-11)15-10-16-14-9-12(24)3-5-18(14)29-20(16)21(19(15)28-17)31-7-1-6-27-22(26)30-25/h2-5,8-10,28-29H,1,6-7H2,(H3,26,27,30) |
| InChIKey | FTKQMYNQTXPDHE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.32 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|