C25H21F2N5O — CID 59238980
2,10-difluoro-6-[5-(1,2,4-triazol-1-yl)pentoxy]-5,7-dihydroindolo[2,3-b]carbazole (PubChem CID 59238980) has the molecular formula C25H21F2N5O and a molecular weight of 445.47 g/mol. Its IUPAC name is 2,10-difluoro-6-[5-(1,2,4-triazol-1-yl)pentoxy]-5,7-dihydroindolo[2,3-b]carbazole.
| Compound Name | 2,10-difluoro-6-[5-(1,2,4-triazol-1-yl)pentoxy]-5,7-dihydroindolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 59238980 |
| Molecular Formula | C25H21F2N5O |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2,10-difluoro-6-[5-(1,2,4-triazol-1-yl)pentoxy]-5,7-dihydroindolo[2,3-b]carbazole |
| SMILES | Fc1ccc2[nH]c3c(OCCCCCn4cncn4)c4[nH]c5ccc(F)cc5c4cc3c2c1 |
| InChI | InChI=1S/C25H21F2N5O/c26-15-4-6-21-17(10-15)19-12-20-18-11-16(27)5-7-22(18)31-24(20)25(23(19)30-21)33-9-3-1-2-8-32-14-28-13-29-32/h4-7,10-14,30-31H,1-3,8-9H2 |
| InChIKey | MVMIGEBEAVHLGV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 71.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|