C20H27NO — CID 143961849
4-but-2-ynylbenzonitrile;ethane;(2E)-5-methylhexa-2,4-dien-3-ol (PubChem CID 143961849) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 4-but-2-ynylbenzonitrile;ethane;(2E)-5-methylhexa-2,4-dien-3-ol.
| Compound Name | 4-but-2-ynylbenzonitrile;ethane;(2E)-5-methylhexa-2,4-dien-3-ol |
|---|---|
| PubChem CID | 143961849 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 4-but-2-ynylbenzonitrile;ethane;(2E)-5-methylhexa-2,4-dien-3-ol |
| SMILES | C/C=C(/O)C=C(C)C.CC.CC#CCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C11H9N.C7H12O.C2H6/c1-2-3-4-10-5-7-11(9-12)8-6-10;1-4-7(8)5-6(2)3;1-2/h5-8H,4H2,1H3;4-5,8H,1-3H3;1-2H3/b;7-4+; |
| InChIKey | ZTIPKNOJAFYGBD-FHVKFMIDSA-N |
| XLogP | 5.56 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|