About 4-but-2-ynylbenzonitrile
4-but-2-ynylbenzonitrile (PubChem CID 143961850) has the molecular formula C11H9N
and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-but-2-ynylbenzonitrile.
Molecular Properties
| Compound Name | 4-but-2-ynylbenzonitrile |
| PubChem CID | 143961850 |
| Molecular Formula | C11H9N |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 4-but-2-ynylbenzonitrile |
| SMILES | CC#CCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C11H9N/c1-2-3-4-10-5-7-11(9-12)8-6-10/h5-8H,4H2,1H3 |
| InChIKey | BGYMNUAKLFDPOP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-but-2-ynylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-2-ynylbenzonitrile?
The IUPAC name of 4-but-2-ynylbenzonitrile (CID 143961850) is 4-but-2-ynylbenzonitrile.
What is the SMILES notation for 4-but-2-ynylbenzonitrile?
The canonical SMILES for 4-but-2-ynylbenzonitrile is CC#CCc1ccc(C#N)cc1.
What is the InChIKey of 4-but-2-ynylbenzonitrile?
The InChIKey is BGYMNUAKLFDPOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N/c1-2-3-4-10-5-7-11(9-12)8-6-10/h5-8H,4H2,1H3.
What are the key properties of 4-but-2-ynylbenzonitrile?
4-but-2-ynylbenzonitrile has a molecular weight of 155.20 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-2-ynylbenzonitrile is sourced from PubChem (CID 143961850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).