C15H29N3O4 — CID 143962924
2-amino-3-hydroxy-N-methyl-N-[2-[methyl(2-oxoheptan-3-yl)amino]-2-oxoethyl]butanamide (PubChem CID 143962924) has the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-amino-3-hydroxy-N-methyl-N-[2-[methyl(2-oxoheptan-3-yl)amino]-2-oxoethyl]butanamide.
| Compound Name | 2-amino-3-hydroxy-N-methyl-N-[2-[methyl(2-oxoheptan-3-yl)amino]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 143962924 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 2-amino-3-hydroxy-N-methyl-N-[2-[methyl(2-oxoheptan-3-yl)amino]-2-oxoethyl]butanamide |
| SMILES | CCCCC(C(C)=O)N(C)C(=O)CN(C)C(=O)C(N)C(C)O |
| InChI | InChI=1S/C15H29N3O4/c1-6-7-8-12(10(2)19)18(5)13(21)9-17(4)15(22)14(16)11(3)20/h11-12,14,20H,6-9,16H2,1-5H3 |
| InChIKey | GQWSSNOZMCZVDG-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |