C21H34 — CID 143963290
1-[(E)-3-ethylhept-3-enyl]cyclohexa-1,3-diene;1-methylcyclopentene (PubChem CID 143963290) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is 1-[(E)-3-ethylhept-3-enyl]cyclohexa-1,3-diene;1-methylcyclopentene.
| Compound Name | 1-[(E)-3-ethylhept-3-enyl]cyclohexa-1,3-diene;1-methylcyclopentene |
|---|---|
| PubChem CID | 143963290 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | 1-[(E)-3-ethylhept-3-enyl]cyclohexa-1,3-diene;1-methylcyclopentene |
| SMILES | CC1=CCCC1.CCC/C=C(\CC)CCC1=CC=CCC1 |
| InChI | InChI=1S/C15H24.C6H10/c1-3-5-9-14(4-2)12-13-15-10-7-6-8-11-15;1-6-4-2-3-5-6/h6-7,9-10H,3-5,8,11-13H2,1-2H3;4H,2-3,5H2,1H3/b14-9+; |
| InChIKey | PWABLKYKRYSMGK-KYIGKLDSSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|