C16H22O — CID 143964202
(5Z,6E)-1-but-3-enyl-5-ethylidene-2-methoxy-6-propylidenecyclohexa-1,3-diene (PubChem CID 143964202) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (5Z,6E)-1-but-3-enyl-5-ethylidene-2-methoxy-6-propylidenecyclohexa-1,3-diene.
| Compound Name | (5Z,6E)-1-but-3-enyl-5-ethylidene-2-methoxy-6-propylidenecyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143964202 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (5Z,6E)-1-but-3-enyl-5-ethylidene-2-methoxy-6-propylidenecyclohexa-1,3-diene |
| SMILES | C=CCCc1c(OC)ccc(=C/C)/c1=C\CC |
| InChI | InChI=1S/C16H22O/c1-5-8-10-15-14(9-6-2)13(7-3)11-12-16(15)17-4/h5,7,9,11-12H,1,6,8,10H2,2-4H3/b13-7-,14-9+ |
| InChIKey | FDRMYBGQROVAJI-MHIRLISYSA-N |
| XLogP | 2.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|