C18H30N2O — CID 14396427
(1R,2R,9S,10S,16R)-16-propan-2-yl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one (PubChem CID 14396427) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is (1R,2R,9S,10S,16R)-16-propan-2-yl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one.
| Compound Name | (1R,2R,9S,10S,16R)-16-propan-2-yl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
|---|---|
| PubChem CID | 14396427 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | (1R,2R,9S,10S,16R)-16-propan-2-yl-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
| SMILES | CC(C)[C@@H]1[C@@H]2C[C@@H](CN3C(=O)CCC[C@H]23)[C@@H]2CCCCN12 |
| InChI | InChI=1S/C18H30N2O/c1-12(2)18-14-10-13(15-6-3-4-9-19(15)18)11-20-16(14)7-5-8-17(20)21/h12-16,18H,3-11H2,1-2H3/t13-,14+,15-,16+,18+/m0/s1 |
| InChIKey | LEDOZABHJUUHKJ-IMSKVBIZSA-N |
| XLogP | 2.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |