C18H32N2O2Si — CID 618801
16-trimethylsilyloxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one (PubChem CID 618801) has the molecular formula C18H32N2O2Si and a molecular weight of 336.55 g/mol. Its IUPAC name is 16-trimethylsilyloxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one.
| Compound Name | 16-trimethylsilyloxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
|---|---|
| PubChem CID | 618801 |
| Molecular Formula | C18H32N2O2Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 16-trimethylsilyloxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
| SMILES | C[Si](C)(C)OC1C2CC(CN3C(=O)CCCC23)C2CCCCN21 |
| InChI | InChI=1S/C18H32N2O2Si/c1-23(2,3)22-18-14-11-13(15-7-4-5-10-19(15)18)12-20-16(14)8-6-9-17(20)21/h13-16,18H,4-12H2,1-3H3 |
| InChIKey | URQUTTBALGFZAX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|