C17H28N2O5S — CID 143964814
4-tert-butylsulfanyloxane;2-(5-formamido-1,2-oxazol-3-yl)-2-methylpropanoic acid (PubChem CID 143964814) has the molecular formula C17H28N2O5S and a molecular weight of 372.49 g/mol. Its IUPAC name is 4-tert-butylsulfanyloxane;2-(5-formamido-1,2-oxazol-3-yl)-2-methylpropanoic acid.
| Compound Name | 4-tert-butylsulfanyloxane;2-(5-formamido-1,2-oxazol-3-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 143964814 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-tert-butylsulfanyloxane;2-(5-formamido-1,2-oxazol-3-yl)-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1cc(NC=O)on1.CC(C)(C)SC1CCOCC1 |
| InChI | InChI=1S/C9H18OS.C8H10N2O4/c1-9(2,3)11-8-4-6-10-7-5-8;1-8(2,7(12)13)5-3-6(9-4-11)14-10-5/h8H,4-7H2,1-3H3;3-4H,1-2H3,(H,9,11)(H,12,13) |
| InChIKey | HSIYJYJXQKQMLW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|