C8H10N2O4 — CID 143964815
2-(5-formamido-1,2-oxazol-3-yl)-2-methylpropanoic acid (PubChem CID 143964815) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-(5-formamido-1,2-oxazol-3-yl)-2-methylpropanoic acid.
| Compound Name | 2-(5-formamido-1,2-oxazol-3-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 143964815 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2-(5-formamido-1,2-oxazol-3-yl)-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1cc(NC=O)on1 |
| InChI | InChI=1S/C8H10N2O4/c1-8(2,7(12)13)5-3-6(9-4-11)14-10-5/h3-4H,1-2H3,(H,9,11)(H,12,13) |
| InChIKey | GDSBKILGBQDUMZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|