C18H22N3O5S2+ — CID 143964823
CID 143964823 (PubChem CID 143964823) has the molecular formula C18H22N3O5S2+ and a molecular weight of 424.52 g/mol.
| Compound Name | CID 143964823 |
|---|---|
| PubChem CID | 143964823 |
| Molecular Formula | C18H22N3O5S2+ |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | — |
| SMILES | CC(C)(CO)c1cc(NC(=O)C(C)(C)[S+](=O)(O)c2ccc3ncsc3c2)on1 |
| InChI | InChI=1S/C18H21N3O5S2/c1-17(2,9-22)14-8-15(26-21-14)20-16(23)18(3,4)28(24,25)11-5-6-12-13(7-11)27-10-19-12/h5-8,10,22H,9H2,1-4H3,(H-,20,21,23,24,25)/p+1 |
| InChIKey | HDYMZSZIUULIDH-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|