C27H31N3S — CID 143965162
(E)-2-[5-[(E)-2-methylbut-1-enyl]-1-(4-methylphenyl)pyrazol-4-yl]-N-[(4-methylphenyl)methyl]but-2-enethioamide (PubChem CID 143965162) has the molecular formula C27H31N3S and a molecular weight of 429.63 g/mol. Its IUPAC name is (E)-2-[5-[(E)-2-methylbut-1-enyl]-1-(4-methylphenyl)pyrazol-4-yl]-N-[(4-methylphenyl)methyl]but-2-enethioamide.
| Compound Name | (E)-2-[5-[(E)-2-methylbut-1-enyl]-1-(4-methylphenyl)pyrazol-4-yl]-N-[(4-methylphenyl)methyl]but-2-enethioamide |
|---|---|
| PubChem CID | 143965162 |
| Molecular Formula | C27H31N3S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (E)-2-[5-[(E)-2-methylbut-1-enyl]-1-(4-methylphenyl)pyrazol-4-yl]-N-[(4-methylphenyl)methyl]but-2-enethioamide |
| SMILES | C/C=C(/C(=S)NCc1ccc(C)cc1)c1cnn(-c2ccc(C)cc2)c1/C=C(\C)CC |
| InChI | InChI=1S/C27H31N3S/c1-6-19(3)16-26-25(18-29-30(26)23-14-10-21(5)11-15-23)24(7-2)27(31)28-17-22-12-8-20(4)9-13-22/h7-16,18H,6,17H2,1-5H3,(H,28,31)/b19-16+,24-7+ |
| InChIKey | AITSJSBNXPXJEA-GZVAWDHVSA-N |
| XLogP | 6.82 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|