C26H31FN4O3S — CID 143965496
(E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[(5-ethylsulfonyl-3-pyridinyl)methyl]but-2-enamide;propane (PubChem CID 143965496) has the molecular formula C26H31FN4O3S and a molecular weight of 498.62 g/mol. Its IUPAC name is (E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[(5-ethylsulfonyl-3-pyridinyl)methyl]but-2-enamide;propane.
| Compound Name | (E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[(5-ethylsulfonyl-3-pyridinyl)methyl]but-2-enamide;propane |
|---|---|
| PubChem CID | 143965496 |
| Molecular Formula | C26H31FN4O3S |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | (E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[(5-ethylsulfonyl-3-pyridinyl)methyl]but-2-enamide;propane |
| SMILES | C=Cc1c(/C(=C\C)C(=O)NCc2cncc(S(=O)(=O)CC)c2)cnn1-c1ccc(F)cc1.CCC |
| InChI | InChI=1S/C23H23FN4O3S.C3H8/c1-4-20(21-15-27-28(22(21)5-2)18-9-7-17(24)8-10-18)23(29)26-13-16-11-19(14-25-12-16)32(30,31)6-3;1-3-2/h4-5,7-12,14-15H,2,6,13H2,1,3H3,(H,26,29);3H2,1-2H3/b20-4+; |
| InChIKey | UVESZHWMQMJVKG-QHZRUGQESA-N |
| XLogP | 4.98 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|