C22H24FN5O2S — CID 143965606
(E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[1-(1-methylsulfinylpyrazol-3-yl)propyl]but-2-enamide (PubChem CID 143965606) has the molecular formula C22H24FN5O2S and a molecular weight of 441.53 g/mol. Its IUPAC name is (E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[1-(1-methylsulfinylpyrazol-3-yl)propyl]but-2-enamide.
| Compound Name | (E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[1-(1-methylsulfinylpyrazol-3-yl)propyl]but-2-enamide |
|---|---|
| PubChem CID | 143965606 |
| Molecular Formula | C22H24FN5O2S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[1-(1-methylsulfinylpyrazol-3-yl)propyl]but-2-enamide |
| SMILES | C=Cc1c(/C(=C\C)C(=O)NC(CC)c2ccn(S(C)=O)n2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FN5O2S/c1-5-17(22(29)25-19(6-2)20-12-13-27(26-20)31(4)30)18-14-24-28(21(18)7-3)16-10-8-15(23)9-11-16/h5,7-14,19H,3,6H2,1-2,4H3,(H,25,29)/b17-5+ |
| InChIKey | UFAHHDMVNXCJCD-YAXRCOADSA-N |
| XLogP | 3.66 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|