C25H28FN3OS — CID 90778567
2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-5-methylidene-N-(1-thiophen-2-ylpropyl)hept-2-enamide (PubChem CID 90778567) has the molecular formula C25H28FN3OS and a molecular weight of 437.58 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-5-methylidene-N-(1-thiophen-2-ylpropyl)hept-2-enamide.
| Compound Name | 2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-5-methylidene-N-(1-thiophen-2-ylpropyl)hept-2-enamide |
|---|---|
| PubChem CID | 90778567 |
| Molecular Formula | C25H28FN3OS |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-5-methylidene-N-(1-thiophen-2-ylpropyl)hept-2-enamide |
| SMILES | C=C(CC)CC=C(C(=O)NC(CC)c1cccs1)c1cnn(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C25H28FN3OS/c1-5-17(3)9-14-21(25(30)28-23(6-2)24-8-7-15-31-24)22-16-27-29(18(22)4)20-12-10-19(26)11-13-20/h7-8,10-16,23H,3,5-6,9H2,1-2,4H3,(H,28,30) |
| InChIKey | KZYQYNKZGKQMAT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|