C20H23FN2 — CID 91312702
1-(4-fluorophenyl)-5-methyl-4-(2-methyl-6-methylideneocta-1,3-dien-3-yl)pyrazole (PubChem CID 91312702) has the molecular formula C20H23FN2 and a molecular weight of 310.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-methyl-4-(2-methyl-6-methylideneocta-1,3-dien-3-yl)pyrazole.
| Compound Name | 1-(4-fluorophenyl)-5-methyl-4-(2-methyl-6-methylideneocta-1,3-dien-3-yl)pyrazole |
|---|---|
| PubChem CID | 91312702 |
| Molecular Formula | C20H23FN2 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-(4-fluorophenyl)-5-methyl-4-(2-methyl-6-methylideneocta-1,3-dien-3-yl)pyrazole |
| SMILES | C=C(CC)CC=C(C(=C)C)c1cnn(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C20H23FN2/c1-6-15(4)7-12-19(14(2)3)20-13-22-23(16(20)5)18-10-8-17(21)9-11-18/h8-13H,2,4,6-7H2,1,3,5H3 |
| InChIKey | GLTLFMQJWZWJEA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|