C27H31FN4O3S — CID 90866178
N-[1-(5-ethylsulfonyl-3-pyridinyl)ethyl]-2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-5-methylidenehept-2-enamide (PubChem CID 90866178) has the molecular formula C27H31FN4O3S and a molecular weight of 510.64 g/mol. Its IUPAC name is N-[1-(5-ethylsulfonyl-3-pyridinyl)ethyl]-2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-5-methylidenehept-2-enamide.
| Compound Name | N-[1-(5-ethylsulfonyl-3-pyridinyl)ethyl]-2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-5-methylidenehept-2-enamide |
|---|---|
| PubChem CID | 90866178 |
| Molecular Formula | C27H31FN4O3S |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | N-[1-(5-ethylsulfonyl-3-pyridinyl)ethyl]-2-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-5-methylidenehept-2-enamide |
| SMILES | C=C(CC)CC=C(C(=O)NC(C)c1cncc(S(=O)(=O)CC)c1)c1cnn(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C27H31FN4O3S/c1-6-18(3)8-13-25(26-17-30-32(20(26)5)23-11-9-22(28)10-12-23)27(33)31-19(4)21-14-24(16-29-15-21)36(34,35)7-2/h9-17,19H,3,6-8H2,1-2,4-5H3,(H,31,33) |
| InChIKey | SQUVMWOYMYABJA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|