C26H28FN3O2S — CID 143965349
(E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[1-(4-hydroxy-3-methylsulfanylphenyl)butyl]but-2-enamide (PubChem CID 143965349) has the molecular formula C26H28FN3O2S and a molecular weight of 465.59 g/mol. Its IUPAC name is (E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[1-(4-hydroxy-3-methylsulfanylphenyl)butyl]but-2-enamide.
| Compound Name | (E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[1-(4-hydroxy-3-methylsulfanylphenyl)butyl]but-2-enamide |
|---|---|
| PubChem CID | 143965349 |
| Molecular Formula | C26H28FN3O2S |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | (E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[1-(4-hydroxy-3-methylsulfanylphenyl)butyl]but-2-enamide |
| SMILES | C=Cc1c(/C(=C\C)C(=O)NC(CCC)c2ccc(O)c(SC)c2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H28FN3O2S/c1-5-8-22(17-9-14-24(31)25(15-17)33-4)29-26(32)20(6-2)21-16-28-30(23(21)7-3)19-12-10-18(27)11-13-19/h6-7,9-16,22,31H,3,5,8H2,1-2,4H3,(H,29,32)/b20-6+ |
| InChIKey | URFWZRYGTBQOOP-CGOBSMCZSA-N |
| XLogP | 6.14 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|