C23H25BrFN3OS — CID 143965104
(E)-N-[(5-bromothiophen-2-yl)methyl]-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]but-2-enamide;propane (PubChem CID 143965104) has the molecular formula C23H25BrFN3OS and a molecular weight of 490.44 g/mol. Its IUPAC name is (E)-N-[(5-bromothiophen-2-yl)methyl]-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]but-2-enamide;propane.
| Compound Name | (E)-N-[(5-bromothiophen-2-yl)methyl]-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]but-2-enamide;propane |
|---|---|
| PubChem CID | 143965104 |
| Molecular Formula | C23H25BrFN3OS |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (E)-N-[(5-bromothiophen-2-yl)methyl]-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]but-2-enamide;propane |
| SMILES | C=Cc1c(/C(=C\C)C(=O)NCc2ccc(Br)s2)cnn1-c1ccc(F)cc1.CCC |
| InChI | InChI=1S/C20H17BrFN3OS.C3H8/c1-3-16(20(26)23-11-15-9-10-19(21)27-15)17-12-24-25(18(17)4-2)14-7-5-13(22)6-8-14;1-3-2/h3-10,12H,2,11H2,1H3,(H,23,26);3H2,1-2H3/b16-3+; |
| InChIKey | GAMGTTWHIFECEN-LIXKLSGSSA-N |
| XLogP | 6.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|