C27H30FN3O3S — CID 143965671
(E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[1-(4-methoxy-3-methylsulfinylphenyl)butyl]but-2-enamide (PubChem CID 143965671) has the molecular formula C27H30FN3O3S and a molecular weight of 495.62 g/mol. Its IUPAC name is (E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[1-(4-methoxy-3-methylsulfinylphenyl)butyl]but-2-enamide.
| Compound Name | (E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[1-(4-methoxy-3-methylsulfinylphenyl)butyl]but-2-enamide |
|---|---|
| PubChem CID | 143965671 |
| Molecular Formula | C27H30FN3O3S |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (E)-2-[5-ethenyl-1-(4-fluorophenyl)pyrazol-4-yl]-N-[1-(4-methoxy-3-methylsulfinylphenyl)butyl]but-2-enamide |
| SMILES | C=Cc1c(/C(=C\C)C(=O)NC(CCC)c2ccc(OC)c(S(C)=O)c2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H30FN3O3S/c1-6-9-23(18-10-15-25(34-4)26(16-18)35(5)33)30-27(32)21(7-2)22-17-29-31(24(22)8-3)20-13-11-19(28)12-14-20/h7-8,10-17,23H,3,6,9H2,1-2,4-5H3,(H,30,32)/b21-7+ |
| InChIKey | BGAVOSSGEBOORC-QPSGOUHRSA-N |
| XLogP | 5.46 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|