C29H37N5O2S — CID 143965252
(E)-N-[[6-[2-methoxyethyl(methylsulfanyl)amino]-3-pyridinyl]methyl]-2-[5-[(E)-2-methylbut-1-enyl]-1-(4-methylphenyl)pyrazol-4-yl]but-2-enamide (PubChem CID 143965252) has the molecular formula C29H37N5O2S and a molecular weight of 519.72 g/mol. Its IUPAC name is (E)-N-[[6-[2-methoxyethyl(methylsulfanyl)amino]-3-pyridinyl]methyl]-2-[5-[(E)-2-methylbut-1-enyl]-1-(4-methylphenyl)pyrazol-4-yl]but-2-enamide.
| Compound Name | (E)-N-[[6-[2-methoxyethyl(methylsulfanyl)amino]-3-pyridinyl]methyl]-2-[5-[(E)-2-methylbut-1-enyl]-1-(4-methylphenyl)pyrazol-4-yl]but-2-enamide |
|---|---|
| PubChem CID | 143965252 |
| Molecular Formula | C29H37N5O2S |
| Molecular Weight | 519.72 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | (E)-N-[[6-[2-methoxyethyl(methylsulfanyl)amino]-3-pyridinyl]methyl]-2-[5-[(E)-2-methylbut-1-enyl]-1-(4-methylphenyl)pyrazol-4-yl]but-2-enamide |
| SMILES | C/C=C(/C(=O)NCc1ccc(N(CCOC)SC)nc1)c1cnn(-c2ccc(C)cc2)c1/C=C(\C)CC |
| InChI | InChI=1S/C29H37N5O2S/c1-7-21(3)17-27-26(20-32-34(27)24-12-9-22(4)10-13-24)25(8-2)29(35)31-19-23-11-14-28(30-18-23)33(37-6)15-16-36-5/h8-14,17-18,20H,7,15-16,19H2,1-6H3,(H,31,35)/b21-17+,25-8+ |
| InChIKey | YQESSZRQEHRPTR-DTBOWVASSA-N |
| XLogP | 5.84 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.72 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|