C19H18FNO3 — CID 143968603
(E)-3-[1-[(3-fluorophenyl)methyl]-5-methoxy-3a,7a-dihydroindol-2-yl]prop-2-enoic acid (PubChem CID 143968603) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is (E)-3-[1-[(3-fluorophenyl)methyl]-5-methoxy-3a,7a-dihydroindol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[(3-fluorophenyl)methyl]-5-methoxy-3a,7a-dihydroindol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 143968603 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (E)-3-[1-[(3-fluorophenyl)methyl]-5-methoxy-3a,7a-dihydroindol-2-yl]prop-2-enoic acid |
| SMILES | COC1=CC2C=C(/C=C/C(=O)O)N(Cc3cccc(F)c3)C2C=C1 |
| InChI | InChI=1S/C19H18FNO3/c1-24-17-6-7-18-14(11-17)10-16(5-8-19(22)23)21(18)12-13-3-2-4-15(20)9-13/h2-11,14,18H,12H2,1H3,(H,22,23)/b8-5+ |
| InChIKey | ZPPGRIGXMGMOGY-VMPITWQZSA-N |
| XLogP | 3.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|