C16H13N3O — CID 143969091
5-(1-methylindol-5-yl)-1,3-benzoxazol-2-amine (PubChem CID 143969091) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is 5-(1-methylindol-5-yl)-1,3-benzoxazol-2-amine.
| Compound Name | 5-(1-methylindol-5-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 143969091 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 5-(1-methylindol-5-yl)-1,3-benzoxazol-2-amine |
| SMILES | Cn1ccc2cc(-c3ccc4oc(N)nc4c3)ccc21 |
| InChI | InChI=1S/C16H13N3O/c1-19-7-6-12-8-10(2-4-14(12)19)11-3-5-15-13(9-11)18-16(17)20-15/h2-9H,1H3,(H2,17,18) |
| InChIKey | DLUIRIUCUZLMBX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |